trimellitic acid

A summary of the most common chemical descriptors (InChI Key and SMILES codes) for trimellitic acid are summarized together with 3D and 2D structures and relevant physico-chemical properties.

What is trimellitic acid?

The molecule trimellitic acid presents a molecular formula of C9H6O6 and its IUPAC name is benzene-1,2,4-tricarboxylic acid.

3D structure

Cartesian coordinates

Geometry of trimellitic acid in x, y and z coordinates (Å units) to copy/paste elsewhere. Generated with Open Babel software.

2D drawing

 

trimellitic acid ARCGXLSVLAOJQL-UHFFFAOYSA-N chemical compound 2D structure molecule svg
trimellitic acid

 

Molecule descriptors

 
IUPAC nametrimellitic acid
InChI codeInChI=1S/C9H6O6/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15)
InChI KeyARCGXLSVLAOJQL-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)C(=O)O)C(=O)O

Physico-Chemical properties

IUPAC namebenzene-1,2,4-tricarboxylic acid
Molecular formulaC9H6O6
Molecular weight210.14
Melting point (ºC)
Boiling point (ºC)
Density (g/cm3)
Molar refractivity
LogP
Topological polar surface area112

LogP and topological polar surface area (TPSA) values were estimated using Open Babel software.

The n-octanol/water partition coeficient (Kow) data is applied in toxicology and drug research. Kow values are used, to guess the environmental fate of persistent organic pollutants. High partition coefficients values, tend to accumulate in the fatty tissue of organisms. Molecules with a log(Kow) (or LogP) greater than 5 are considered to bioaccumulate.

TPSA values are the sum of the surface area over all polar atoms or molecules, mainly oxygen and nitrogen, also including hydrogen atoms.

In medicinal chemistry, TPSA is used to assess the ability of a drug to permeabilise cells.

For molecules to penetrate the blood-brain barrier (and act on receptors in the central nervous system), TPSA values below 90 Å2 are required. Thus, molecules with a polar surface area greater than 140 Å2 tend to be poorly permeable to cell membranes.