acetic acid pent-4-enyl ester

A summary of the most common chemical descriptors (InChI Key and SMILES codes) for acetic acid pent-4-enyl ester are summarized together with 3D and 2D structures and relevant physico-chemical properties.

What is acetic acid pent-4-enyl ester?

The molecule acetic acid pent-4-enyl ester presents a molecular formula of C7H12O2 and its IUPAC name is pent-4-enyl ethanoate.

3D structure

Cartesian coordinates

Geometry of acetic acid pent-4-enyl ester in x, y and z coordinates (Å units) to copy/paste elsewhere. Generated with Open Babel software.

2D drawing

 

acetic acid pent-4-enyl ester LVHDNIMNOMRZMF-UHFFFAOYSA-N chemical compound 2D structure molecule svg
acetic acid pent-4-enyl ester

 

Molecule descriptors

 
IUPAC nameacetic acid pent-4-enyl ester
InChI codeInChI=1S/C7H12O2/c1-3-4-5-6-9-7(2)8/h3H,1,4-6H2,2H3
InChI KeyLVHDNIMNOMRZMF-UHFFFAOYSA-N
SMILESCC(=O)OCCCC=C

Physico-Chemical properties

IUPAC namepent-4-enyl ethanoate
Molecular formulaC7H12O2
Molecular weight128.17
Melting point (ºC)
Boiling point (ºC)
Density (g/cm3)
Molar refractivity
LogP1.6
Topological polar surface area26.3

LogP and topological polar surface area (TPSA) values were estimated using Open Babel software.

The n-octanol/water partition coeficient (Kow) data is applied in toxicology and drug research. Kow values are used, to guess the environmental fate of persistent organic pollutants. High partition coefficients values, tend to accumulate in the fatty tissue of organisms. Molecules with a log(Kow) (or LogP) greater than 5 are considered to bioaccumulate.

TPSA values are the sum of the surface area over all polar atoms or molecules, mainly oxygen and nitrogen, also including hydrogen atoms.

In medicinal chemistry, TPSA is used to assess the ability of a drug to permeabilise cells.

For molecules to penetrate the blood-brain barrier (and act on receptors in the central nervous system), TPSA values below 90 Å2 are required. Thus, molecules with a polar surface area greater than 140 Å2 tend to be poorly permeable to cell membranes.