What is the molecular formula of (1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane?

(1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane has a molecular formula of C11H19Br

What is the InChI Key of (1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane molecule?

The InChI Key of (1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane is: MELJETAUKUKDJS-UTLUCORTSA-N.

(1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane

A summary of the most common chemical descriptors (InChI Key and SMILES codes) for (1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane are summarized together with 3D and 2D structures and relevant physico-chemical properties.

Table of Contents

1. What is (1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane?
2. 3D Structure
3. Cartesian coordinates
4. 2D Drawing
5. Molecule descriptors
6. Physico-Chemical properties

What is (1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane?

The molecule (1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane presents a molecular formula of C11H19Br and its IUPAC name is (1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-bicyclo[2.2.1]heptane.

3D structure

Cartesian coordinates

Geometry of (1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane in x, y and z coordinates (Å units) to copy/paste elsewhere. Generated with Open Babel software.

2D drawing

(1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane MELJETAUKUKDJS-UTLUCORTSA-N chemical compound 2D structure molecule svg — (1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane

Molecule descriptors

IUPAC name	(1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-norbornane
InChI code	InChI=1S/C11H19Br/c1-11(2)9-4-3-8(7-9)10(11)5-6-12/h8-10H,3-7H2,1-2H3/t8-,9+,10+/m1/s1
InChI Key	MELJETAUKUKDJS-UTLUCORTSA-N
SMILES	CC1([C@H]2CC[C@H](C2)[C@@H]1CCBr)C

Physico-Chemical properties

IUPAC name	(1S,3S,4R)-3-(2-bromoethyl)-2,2-dimethyl-bicyclo[2.2.1]heptane
Molecular formula	C11H19Br
Molecular weight	231.17
Melting point (ºC)
Boiling point (ºC)
Density (g/cm³)
Molar refractivity
LogP	4.5
Topological polar surface area	0

LogP and topological polar surface area (TPSA) values were estimated using Open Babel software.

The n-octanol/water partition coeficient (K_ow) data is applied in toxicology and drug research. K_ow values are used, to guess the environmental fate of persistent organic pollutants. High partition coefficients values, tend to accumulate in the fatty tissue of organisms. Molecules with a log(K_ow) (or LogP) greater than 5 are considered to bioaccumulate.

TPSA values are the sum of the surface area over all polar atoms or molecules, mainly oxygen and nitrogen, also including hydrogen atoms.

In medicinal chemistry, TPSA is used to assess the ability of a drug to permeabilise cells.

For molecules to penetrate the blood-brain barrier (and act on receptors in the central nervous system), TPSA values below 90 Å² are required. Thus, molecules with a polar surface area greater than 140 Å² tend to be poorly permeable to cell membranes.