What is the molecular formula of (1E)-2-chloro-6-fluoro-benzaldoxime?

(1E)-2-chloro-6-fluoro-benzaldoxime has a molecular formula of C7H5ClFNO

What is the InChI Key of (1E)-2-chloro-6-fluoro-benzaldoxime molecule?

The InChI Key of (1E)-2-chloro-6-fluoro-benzaldoxime is: OBJHLLOVMKKXDI-ONNFQVAWSA-N.

What is the molecular weight of (1E)-2-chloro-6-fluoro-benzaldoxime?

(1E)-2-chloro-6-fluoro-benzaldoxime presents a molecular weight of 173.57 g/mol.

(1E)-2-chloro-6-fluoro-benzaldoxime

A summary of the most common chemical descriptors (InChI Key and SMILES codes) for (1E)-2-chloro-6-fluoro-benzaldoxime are summarized together with 3D and 2D structures and relevant physico-chemical properties.

Table of Contents

1. What is (1E)-2-chloro-6-fluoro-benzaldoxime?
2. 3D Structure
3. Cartesian coordinates
4. 2D Drawing
5. Molecule descriptors
6. Physico-Chemical properties

What is (1E)-2-chloro-6-fluoro-benzaldoxime?

The molecule (1E)-2-chloro-6-fluoro-benzaldoxime presents a molecular formula of C7H5ClFNO and its IUPAC name is (NE)-N-[(2-chloranyl-6-fluoranyl-phenyl)methylidene]hydroxylamine.

3D structure

Cartesian coordinates

Geometry of (1E)-2-chloro-6-fluoro-benzaldoxime in x, y and z coordinates (Å units) to copy/paste elsewhere. Generated with Open Babel software.

2D drawing

(1E)-2-chloro-6-fluoro-benzaldoxime OBJHLLOVMKKXDI-ONNFQVAWSA-N chemical compound 2D structure molecule svg — (1E)-2-chloro-6-fluoro-benzaldoxime

Molecule descriptors

IUPAC name	(1E)-2-chloro-6-fluoro-benzaldoxime
InChI code	InChI=1S/C7H5ClFNO/c8-6-2-1-3-7(9)5(6)4-10-11/h1-4,11H/b10-4+
InChI Key	OBJHLLOVMKKXDI-ONNFQVAWSA-N
SMILES	C1=CC(=C(C(=C1)Cl)/C=N/O)F

Physico-Chemical properties

IUPAC name	(NE)-N-[(2-chloranyl-6-fluoranyl-phenyl)methylidene]hydroxylamine
Molecular formula	C7H5ClFNO
Molecular weight	173.57
Melting point (ºC)
Boiling point (ºC)
Density (g/cm³)
Molar refractivity
LogP	2.4
Topological polar surface area	32.6

LogP and topological polar surface area (TPSA) values were estimated using Open Babel software.

The n-octanol/water partition coeficient (K_ow) data is applied in toxicology and drug research. K_ow values are used, to guess the environmental fate of persistent organic pollutants. High partition coefficients values, tend to accumulate in the fatty tissue of organisms. Molecules with a log(K_ow) (or LogP) greater than 5 are considered to bioaccumulate.

TPSA values are the sum of the surface area over all polar atoms or molecules, mainly oxygen and nitrogen, also including hydrogen atoms.

In medicinal chemistry, TPSA is used to assess the ability of a drug to permeabilise cells.

For molecules to penetrate the blood-brain barrier (and act on receptors in the central nervous system), TPSA values below 90 Å² are required. Thus, molecules with a polar surface area greater than 140 Å² tend to be poorly permeable to cell membranes.