5-amino-4-keto-valeric acid hexyl ester

A summary of the most common chemical descriptors (InChI Key and SMILES codes) for 5-amino-4-keto-valeric acid hexyl ester are summarized together with 3D and 2D structures and relevant physico-chemical properties.

What is 5-amino-4-keto-valeric acid hexyl ester?

The molecule 5-amino-4-keto-valeric acid hexyl ester presents a molecular formula of C11H21NO3 and its IUPAC name is hexyl 5-azanyl-4-oxidanylidene-pentanoate.

3D structure

Cartesian coordinates

Geometry of 5-amino-4-keto-valeric acid hexyl ester in x, y and z coordinates (Å units) to copy/paste elsewhere. Generated with Open Babel software.

2D drawing

 

5-amino-4-keto-valeric acid hexyl ester RYQOILLJDKPETL-UHFFFAOYSA-N chemical compound 2D structure molecule svg
5-amino-4-keto-valeric acid hexyl ester

 

Molecule descriptors

 
IUPAC name5-amino-4-keto-valeric acid hexyl ester
InChI codeInChI=1S/C11H21NO3/c1-2-3-4-5-8-15-11(14)7-6-10(13)9-12/h2-9,12H2,1H3
InChI KeyRYQOILLJDKPETL-UHFFFAOYSA-N
SMILESCCCCCCOC(=O)CCC(=O)CN

Physico-Chemical properties

IUPAC namehexyl 5-azanyl-4-oxidanylidene-pentanoate
Molecular formulaC11H21NO3
Molecular weight215.29
Melting point (ºC)
Boiling point (ºC)
Density (g/cm3)
Molar refractivity
LogP1.1
Topological polar surface area69.4

LogP and topological polar surface area (TPSA) values were estimated using Open Babel software.

The n-octanol/water partition coeficient (Kow) data is applied in toxicology and drug research. Kow values are used, to guess the environmental fate of persistent organic pollutants. High partition coefficients values, tend to accumulate in the fatty tissue of organisms. Molecules with a log(Kow) (or LogP) greater than 5 are considered to bioaccumulate.

TPSA values are the sum of the surface area over all polar atoms or molecules, mainly oxygen and nitrogen, also including hydrogen atoms.

In medicinal chemistry, TPSA is used to assess the ability of a drug to permeabilise cells.

For molecules to penetrate the blood-brain barrier (and act on receptors in the central nervous system), TPSA values below 90 Å2 are required. Thus, molecules with a polar surface area greater than 140 Å2 tend to be poorly permeable to cell membranes.