but-2-ynoic acid methyl ester
A summary of the most common chemical descriptors (InChI Key and SMILES codes) for but-2-ynoic acid methyl ester are summarized together with 3D and 2D structures and relevant physico-chemical properties.
Table of Contents
What is but-2-ynoic acid methyl ester?
The molecule but-2-ynoic acid methyl ester presents a molecular formula of C5H6O2 and its IUPAC name is methyl but-2-ynoate.
3D structure
Cartesian coordinates
Geometry of but-2-ynoic acid methyl ester in x, y and z coordinates (Å units) to copy/paste elsewhere. Generated with Open Babel software.
2D drawing
Molecule descriptors
| IUPAC name | but-2-ynoic acid methyl ester |
| InChI code | InChI=1S/C5H6O2/c1-3-4-5(6)7-2/h1-2H3 |
| InChI Key | UJQCANQILFWSDJ-UHFFFAOYSA-N |
| SMILES | CC#CC(=O)OC |
Physico-Chemical properties
| IUPAC name | methyl but-2-ynoate |
| Molecular formula | C5H6O2 |
| Molecular weight | 98.10 |
| Melting point (ºC) | |
| Boiling point (ºC) | |
| Density (g/cm3) | |
| Molar refractivity | |
| LogP | 1.1 |
| Topological polar surface area | 26.3 |
LogP and topological polar surface area (TPSA) values were estimated using Open Babel software.
The n-octanol/water partition coeficient (Kow) data is applied in toxicology and drug research. Kow values are used, to guess the environmental fate of persistent organic pollutants. High partition coefficients values, tend to accumulate in the fatty tissue of organisms. Molecules with a log(Kow) (or LogP) greater than 5 are considered to bioaccumulate.
TPSA values are the sum of the surface area over all polar atoms or molecules, mainly oxygen and nitrogen, also including hydrogen atoms.
In medicinal chemistry, TPSA is used to assess the ability of a drug to permeabilise cells.
For molecules to penetrate the blood-brain barrier (and act on receptors in the central nervous system), TPSA values below 90 Å2 are required. Thus, molecules with a polar surface area greater than 140 Å2 tend to be poorly permeable to cell membranes.